C21H40 — CID 123849203
1-methylidene-2-(3,7,11-trimethyldodecyl)cyclopentane (PubChem CID 123849203) has the molecular formula C21H40 and a molecular weight of 292.55 g/mol. Its IUPAC name is 1-methylidene-2-(3,7,11-trimethyldodecyl)cyclopentane.
| Compound Name | 1-methylidene-2-(3,7,11-trimethyldodecyl)cyclopentane |
|---|---|
| PubChem CID | 123849203 |
| Molecular Formula | C21H40 |
| Molecular Weight | 292.55 g/mol |
| Exact Mass | 292.31 |
| IUPAC Name | 1-methylidene-2-(3,7,11-trimethyldodecyl)cyclopentane |
| SMILES | C=C1CCCC1CCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C21H40/c1-17(2)9-6-10-18(3)11-7-12-19(4)15-16-21-14-8-13-20(21)5/h17-19,21H,5-16H2,1-4H3 |
| InChIKey | OVFXGFUUSSZLTP-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.55 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|