C27H30F3NO2 — CID 123849530
1-[(1S,2R,3R,4aS,8aR)-3-(hydroxymethyl)-1-[2-[5-[3-(trifluoromethyl)phenyl]-2-pyridinyl]ethenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]ethanone (PubChem CID 123849530) has the molecular formula C27H30F3NO2 and a molecular weight of 457.54 g/mol. Its IUPAC name is 1-[(1S,2R,3R,4aS,8aR)-3-(hydroxymethyl)-1-[2-[5-[3-(trifluoromethyl)phenyl]-2-pyridinyl]ethenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]ethanone.
| Compound Name | 1-[(1S,2R,3R,4aS,8aR)-3-(hydroxymethyl)-1-[2-[5-[3-(trifluoromethyl)phenyl]-2-pyridinyl]ethenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]ethanone |
|---|---|
| PubChem CID | 123849530 |
| Molecular Formula | C27H30F3NO2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 1-[(1S,2R,3R,4aS,8aR)-3-(hydroxymethyl)-1-[2-[5-[3-(trifluoromethyl)phenyl]-2-pyridinyl]ethenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]ethanone |
| SMILES | CC(=O)[C@H]1[C@H](CO)C[C@@H]2CCCC[C@H]2[C@@H]1C=Cc1ccc(-c2cccc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C27H30F3NO2/c1-17(33)26-21(16-32)13-19-5-2-3-8-24(19)25(26)12-11-23-10-9-20(15-31-23)18-6-4-7-22(14-18)27(28,29)30/h4,6-7,9-12,14-15,19,21,24-26,32H,2-3,5,8,13,16H2,1H3/t19-,21-,24+,25-,26-/m0/s1 |
| InChIKey | RMKRPLXGXNXSNS-UFAJOCFKSA-N |
| XLogP | 6.42 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |