C16H26O3 — CID 123850062
2,5,11-trimethyl-9-propan-2-yl-6,12-dioxatetracyclo[7.2.1.02,7.05,7]dodecan-8-ol (PubChem CID 123850062) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 2,5,11-trimethyl-9-propan-2-yl-6,12-dioxatetracyclo[7.2.1.02,7.05,7]dodecan-8-ol.
| Compound Name | 2,5,11-trimethyl-9-propan-2-yl-6,12-dioxatetracyclo[7.2.1.02,7.05,7]dodecan-8-ol |
|---|---|
| PubChem CID | 123850062 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 2,5,11-trimethyl-9-propan-2-yl-6,12-dioxatetracyclo[7.2.1.02,7.05,7]dodecan-8-ol |
| SMILES | CC1CC2(C(C)C)OC1C1(C)CCC3(C)OC31C2O |
| InChI | InChI=1S/C16H26O3/c1-9(2)15-8-10(3)11(18-15)13(4)6-7-14(5)16(13,19-14)12(15)17/h9-12,17H,6-8H2,1-5H3 |
| InChIKey | QORUUWZJCINJKR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|