C15H24O3 — CID 44597031
(1R,2S,5S,7S,8R,9R)-1,5-dimethyl-9-propan-2-yl-6,12-dioxatetracyclo[7.2.1.02,7.05,7]dodecan-8-ol (PubChem CID 44597031) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1R,2S,5S,7S,8R,9R)-1,5-dimethyl-9-propan-2-yl-6,12-dioxatetracyclo[7.2.1.02,7.05,7]dodecan-8-ol.
| Compound Name | (1R,2S,5S,7S,8R,9R)-1,5-dimethyl-9-propan-2-yl-6,12-dioxatetracyclo[7.2.1.02,7.05,7]dodecan-8-ol |
|---|---|
| PubChem CID | 44597031 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1R,2S,5S,7S,8R,9R)-1,5-dimethyl-9-propan-2-yl-6,12-dioxatetracyclo[7.2.1.02,7.05,7]dodecan-8-ol |
| SMILES | CC(C)[C@@]12CC[C@@](C)(O1)[C@@H]1CC[C@]3(C)O[C@]13[C@@H]2O |
| InChI | InChI=1S/C15H24O3/c1-9(2)14-8-7-12(3,17-14)10-5-6-13(4)15(10,18-13)11(14)16/h9-11,16H,5-8H2,1-4H3/t10-,11+,12+,13-,14+,15-/m0/s1 |
| InChIKey | DWWBLFLDYFSWBH-MTWVNVMRSA-N |
| XLogP | 2.26 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|