C15H26O3 — CID 163193860
(1R,2S,3S,5R,6R,8R)-1,5,9,9-tetramethyl-10-oxatricyclo[6.2.2.02,6]dodecane-3,8-diol (PubChem CID 163193860) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (1R,2S,3S,5R,6R,8R)-1,5,9,9-tetramethyl-10-oxatricyclo[6.2.2.02,6]dodecane-3,8-diol.
| Compound Name | (1R,2S,3S,5R,6R,8R)-1,5,9,9-tetramethyl-10-oxatricyclo[6.2.2.02,6]dodecane-3,8-diol |
|---|---|
| PubChem CID | 163193860 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (1R,2S,3S,5R,6R,8R)-1,5,9,9-tetramethyl-10-oxatricyclo[6.2.2.02,6]dodecane-3,8-diol |
| SMILES | C[C@@H]1C[C@H](O)[C@@H]2[C@@H]1C[C@]1(O)CC[C@@]2(C)OC1(C)C |
| InChI | InChI=1S/C15H26O3/c1-9-7-11(16)12-10(9)8-15(17)6-5-14(12,4)18-13(15,2)3/h9-12,16-17H,5-8H2,1-4H3/t9-,10-,11+,12+,14-,15-/m1/s1 |
| InChIKey | FZHQWUGUAXQAKQ-ZOMUANAPSA-N |
| XLogP | 2.10 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |