C27H29F2N3O4S — CID 123851900
1-acetyl-4-[4-[(3-ethynyl-1,1-dioxo-6-phenylthiazinan-2-yl)methyl]-2,5-difluorophenyl]piperidine-4-carboxamide (PubChem CID 123851900) has the molecular formula C27H29F2N3O4S and a molecular weight of 529.61 g/mol. Its IUPAC name is 1-acetyl-4-[4-[(3-ethynyl-1,1-dioxo-6-phenylthiazinan-2-yl)methyl]-2,5-difluorophenyl]piperidine-4-carboxamide.
| Compound Name | 1-acetyl-4-[4-[(3-ethynyl-1,1-dioxo-6-phenylthiazinan-2-yl)methyl]-2,5-difluorophenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 123851900 |
| Molecular Formula | C27H29F2N3O4S |
| Molecular Weight | 529.61 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | 1-acetyl-4-[4-[(3-ethynyl-1,1-dioxo-6-phenylthiazinan-2-yl)methyl]-2,5-difluorophenyl]piperidine-4-carboxamide |
| SMILES | C#CC1CCC(c2ccccc2)S(=O)(=O)N1Cc1cc(F)c(C2(C(N)=O)CCN(C(C)=O)CC2)cc1F |
| InChI | InChI=1S/C27H29F2N3O4S/c1-3-21-9-10-25(19-7-5-4-6-8-19)37(35,36)32(21)17-20-15-24(29)22(16-23(20)28)27(26(30)34)11-13-31(14-12-27)18(2)33/h1,4-8,15-16,21,25H,9-14,17H2,2H3,(H2,30,34) |
| InChIKey | HMFPATZPRUORBV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.61 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|