C34H25F4NO3 — CID 123852284
5-[[5-[4-(4-cyanophenyl)phenyl]-2-fluoro-4-(trifluoromethyl)phenyl]methoxy]-4-methylidene-1,1a,3,5,7,7a-hexahydrocyclopropa[a]azulene-1-carboxylic acid (PubChem CID 123852284) has the molecular formula C34H25F4NO3 and a molecular weight of 571.57 g/mol. Its IUPAC name is 5-[[5-[4-(4-cyanophenyl)phenyl]-2-fluoro-4-(trifluoromethyl)phenyl]methoxy]-4-methylidene-1,1a,3,5,7,7a-hexahydrocyclopropa[a]azulene-1-carboxylic acid.
| Compound Name | 5-[[5-[4-(4-cyanophenyl)phenyl]-2-fluoro-4-(trifluoromethyl)phenyl]methoxy]-4-methylidene-1,1a,3,5,7,7a-hexahydrocyclopropa[a]azulene-1-carboxylic acid |
|---|---|
| PubChem CID | 123852284 |
| Molecular Formula | C34H25F4NO3 |
| Molecular Weight | 571.57 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 5-[[5-[4-(4-cyanophenyl)phenyl]-2-fluoro-4-(trifluoromethyl)phenyl]methoxy]-4-methylidene-1,1a,3,5,7,7a-hexahydrocyclopropa[a]azulene-1-carboxylic acid |
| SMILES | C=C1CC=C2C(=CC1OCc1cc(-c3ccc(-c4ccc(C#N)cc4)cc3)c(C(F)(F)F)cc1F)CC1C(C(=O)O)C21 |
| InChI | InChI=1S/C34H25F4NO3/c1-18-2-11-25-23(12-27-31(25)32(27)33(40)41)14-30(18)42-17-24-13-26(28(15-29(24)35)34(36,37)38)22-9-7-21(8-10-22)20-5-3-19(16-39)4-6-20/h3-11,13-15,27,30-32H,1-2,12,17H2,(H,40,41) |
| InChIKey | OTAVFAFIHXJIHO-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.57 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|