C31H32F4O5S — CID 123840673
[5-[[2-fluoro-5-[4-(3-methylsulfonylpropoxy)-2-(trifluoromethyl)phenyl]phenyl]methoxy]-4-methylidene-1,1a,3,5,7,7a-hexahydrocyclopropa[a]azulen-1-yl]methanol (PubChem CID 123840673) has the molecular formula C31H32F4O5S and a molecular weight of 592.65 g/mol. Its IUPAC name is [5-[[2-fluoro-5-[4-(3-methylsulfonylpropoxy)-2-(trifluoromethyl)phenyl]phenyl]methoxy]-4-methylidene-1,1a,3,5,7,7a-hexahydrocyclopropa[a]azulen-1-yl]methanol.
| Compound Name | [5-[[2-fluoro-5-[4-(3-methylsulfonylpropoxy)-2-(trifluoromethyl)phenyl]phenyl]methoxy]-4-methylidene-1,1a,3,5,7,7a-hexahydrocyclopropa[a]azulen-1-yl]methanol |
|---|---|
| PubChem CID | 123840673 |
| Molecular Formula | C31H32F4O5S |
| Molecular Weight | 592.65 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | [5-[[2-fluoro-5-[4-(3-methylsulfonylpropoxy)-2-(trifluoromethyl)phenyl]phenyl]methoxy]-4-methylidene-1,1a,3,5,7,7a-hexahydrocyclopropa[a]azulen-1-yl]methanol |
| SMILES | C=C1CC=C2C(=CC1OCc1cc(-c3ccc(OCCCS(C)(=O)=O)cc3C(F)(F)F)ccc1F)CC1C(CO)C21 |
| InChI | InChI=1S/C31H32F4O5S/c1-18-4-7-24-20(13-25-26(16-36)30(24)25)14-29(18)40-17-21-12-19(5-9-28(21)32)23-8-6-22(15-27(23)31(33,34)35)39-10-3-11-41(2,37)38/h5-9,12,14-15,25-26,29-30,36H,1,3-4,10-11,13,16-17H2,2H3 |
| InChIKey | QGQYVJVUPSCMRM-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.65 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|