C17H17F4NO4S — CID 118168698
[2-fluoro-5-[6-(3-methylsulfonylpropoxy)-5-(trifluoromethyl)-3-pyridinyl]phenyl]methanol (PubChem CID 118168698) has the molecular formula C17H17F4NO4S and a molecular weight of 407.39 g/mol. Its IUPAC name is [2-fluoro-5-[6-(3-methylsulfonylpropoxy)-5-(trifluoromethyl)-3-pyridinyl]phenyl]methanol.
| Compound Name | [2-fluoro-5-[6-(3-methylsulfonylpropoxy)-5-(trifluoromethyl)-3-pyridinyl]phenyl]methanol |
|---|---|
| PubChem CID | 118168698 |
| Molecular Formula | C17H17F4NO4S |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | [2-fluoro-5-[6-(3-methylsulfonylpropoxy)-5-(trifluoromethyl)-3-pyridinyl]phenyl]methanol |
| SMILES | CS(=O)(=O)CCCOc1ncc(-c2ccc(F)c(CO)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C17H17F4NO4S/c1-27(24,25)6-2-5-26-16-14(17(19,20)21)8-12(9-22-16)11-3-4-15(18)13(7-11)10-23/h3-4,7-9,23H,2,5-6,10H2,1H3 |
| InChIKey | XWGFKYITEBAEPX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|