C28H30FNO2 — CID 123852456
methyl 2-[2-(4-fluorophenyl)-2-(methylideneamino)-1-phenylethyl]-3-methyl-4-phenylpentanoate (PubChem CID 123852456) has the molecular formula C28H30FNO2 and a molecular weight of 431.55 g/mol. Its IUPAC name is methyl 2-[2-(4-fluorophenyl)-2-(methylideneamino)-1-phenylethyl]-3-methyl-4-phenylpentanoate.
| Compound Name | methyl 2-[2-(4-fluorophenyl)-2-(methylideneamino)-1-phenylethyl]-3-methyl-4-phenylpentanoate |
|---|---|
| PubChem CID | 123852456 |
| Molecular Formula | C28H30FNO2 |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | methyl 2-[2-(4-fluorophenyl)-2-(methylideneamino)-1-phenylethyl]-3-methyl-4-phenylpentanoate |
| SMILES | C=NC(c1ccc(F)cc1)C(c1ccccc1)C(C(=O)OC)C(C)C(C)c1ccccc1 |
| InChI | InChI=1S/C28H30FNO2/c1-19(21-11-7-5-8-12-21)20(2)25(28(31)32-4)26(22-13-9-6-10-14-22)27(30-3)23-15-17-24(29)18-16-23/h5-20,25-27H,3H2,1-2,4H3 |
| InChIKey | JDTXDBLBAOAFAG-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|