C18H20FNO2 — CID 10709430
methyl 4-[4-[amino-(2-fluorophenyl)methyl]phenyl]butanoate (PubChem CID 10709430) has the molecular formula C18H20FNO2 and a molecular weight of 301.36 g/mol. Its IUPAC name is methyl 4-[4-[amino-(2-fluorophenyl)methyl]phenyl]butanoate.
| Compound Name | methyl 4-[4-[amino-(2-fluorophenyl)methyl]phenyl]butanoate |
|---|---|
| PubChem CID | 10709430 |
| Molecular Formula | C18H20FNO2 |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | methyl 4-[4-[amino-(2-fluorophenyl)methyl]phenyl]butanoate |
| SMILES | COC(=O)CCCc1ccc(C(N)c2ccccc2F)cc1 |
| InChI | InChI=1S/C18H20FNO2/c1-22-17(21)8-4-5-13-9-11-14(12-10-13)18(20)15-6-2-3-7-16(15)19/h2-3,6-7,9-12,18H,4-5,8,20H2,1H3 |
| InChIKey | OCGQUTKVNRRCGL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |