C19H36O — CID 123852562
2,2-diethyl-4,8-dimethyl-7-propan-2-ylidenedec-3-en-1-ol (PubChem CID 123852562) has the molecular formula C19H36O and a molecular weight of 280.50 g/mol. Its IUPAC name is 2,2-diethyl-4,8-dimethyl-7-propan-2-ylidenedec-3-en-1-ol.
| Compound Name | 2,2-diethyl-4,8-dimethyl-7-propan-2-ylidenedec-3-en-1-ol |
|---|---|
| PubChem CID | 123852562 |
| Molecular Formula | C19H36O |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.28 |
| IUPAC Name | 2,2-diethyl-4,8-dimethyl-7-propan-2-ylidenedec-3-en-1-ol |
| SMILES | CCC(C)C(CCC(C)=CC(CC)(CC)CO)=C(C)C |
| InChI | InChI=1S/C19H36O/c1-8-17(7)18(15(4)5)12-11-16(6)13-19(9-2,10-3)14-20/h13,17,20H,8-12,14H2,1-7H3 |
| InChIKey | CFGUDACHRJEECU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|