C25H39F — CID 167046089
(2E,4Z,7E,11E)-8-butan-2-yl-3-(1-fluoroethyl)-7,11,14-trimethyl-6-methylidenepentadeca-2,4,7,11,13-pentaene (PubChem CID 167046089) has the molecular formula C25H39F and a molecular weight of 358.59 g/mol. Its IUPAC name is (2E,4Z,7E,11E)-8-butan-2-yl-3-(1-fluoroethyl)-7,11,14-trimethyl-6-methylidenepentadeca-2,4,7,11,13-pentaene.
| Compound Name | (2E,4Z,7E,11E)-8-butan-2-yl-3-(1-fluoroethyl)-7,11,14-trimethyl-6-methylidenepentadeca-2,4,7,11,13-pentaene |
|---|---|
| PubChem CID | 167046089 |
| Molecular Formula | C25H39F |
| Molecular Weight | 358.59 g/mol |
| Exact Mass | 358.30 |
| IUPAC Name | (2E,4Z,7E,11E)-8-butan-2-yl-3-(1-fluoroethyl)-7,11,14-trimethyl-6-methylidenepentadeca-2,4,7,11,13-pentaene |
| SMILES | C=C(/C=C\C(=C/C)C(C)F)/C(C)=C(\CC/C(C)=C/C=C(C)C)C(C)CC |
| InChI | InChI=1S/C25H39F/c1-10-20(6)25(17-14-19(5)13-12-18(3)4)22(8)21(7)15-16-24(11-2)23(9)26/h11-13,15-16,20,23H,7,10,14,17H2,1-6,8-9H3/b16-15-,19-13+,24-11+,25-22+ |
| InChIKey | HBRBHBUZLFXJDH-FSNGLSQNSA-N |
| XLogP | 8.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.59 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|