C13H22O — CID 15511121
(2E,5E)-6-ethyl-5,7-dimethylnona-2,5-dien-4-one (PubChem CID 15511121) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is (2E,5E)-6-ethyl-5,7-dimethylnona-2,5-dien-4-one.
| Compound Name | (2E,5E)-6-ethyl-5,7-dimethylnona-2,5-dien-4-one |
|---|---|
| PubChem CID | 15511121 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | (2E,5E)-6-ethyl-5,7-dimethylnona-2,5-dien-4-one |
| SMILES | C/C=C/C(=O)/C(C)=C(\CC)C(C)CC |
| InChI | InChI=1S/C13H22O/c1-6-9-13(14)11(5)12(8-3)10(4)7-2/h6,9-10H,7-8H2,1-5H3/b9-6+,12-11+ |
| InChIKey | VQVYPHCGDGCYJZ-SQXBUMSNSA-N |
| XLogP | 3.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|