About (3-methyl-2-oxopentyl) (E)-but-2-enoate
(3-methyl-2-oxopentyl) (E)-but-2-enoate (PubChem CID 58048889) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is (3-methyl-2-oxopentyl) (E)-but-2-enoate.
Molecular Properties
| Compound Name | (3-methyl-2-oxopentyl) (E)-but-2-enoate |
| PubChem CID | 58048889 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (3-methyl-2-oxopentyl) (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OCC(=O)C(C)CC |
| InChI | InChI=1S/C10H16O3/c1-4-6-10(12)13-7-9(11)8(3)5-2/h4,6,8H,5,7H2,1-3H3/b6-4+ |
| InChIKey | GHABXFHMTKONJW-GQCTYLIASA-N |
| XLogP | 1.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-2-oxopentyl) (E)-but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-2-oxopentyl) (E)-but-2-enoate?
The IUPAC name of (3-methyl-2-oxopentyl) (E)-but-2-enoate (CID 58048889) is (3-methyl-2-oxopentyl) (E)-but-2-enoate.
What is the SMILES notation for (3-methyl-2-oxopentyl) (E)-but-2-enoate?
The canonical SMILES for (3-methyl-2-oxopentyl) (E)-but-2-enoate is C/C=C/C(=O)OCC(=O)C(C)CC.
What is the InChIKey of (3-methyl-2-oxopentyl) (E)-but-2-enoate?
The InChIKey is GHABXFHMTKONJW-GQCTYLIASA-N. The full InChI is InChI=1S/C10H16O3/c1-4-6-10(12)13-7-9(11)8(3)5-2/h4,6,8H,5,7H2,1-3H3/b6-4+.
What are the key properties of (3-methyl-2-oxopentyl) (E)-but-2-enoate?
(3-methyl-2-oxopentyl) (E)-but-2-enoate has a molecular weight of 184.23 g/mol, XLogP of 1.72, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-2-oxopentyl) (E)-but-2-enoate is sourced from PubChem (CID 58048889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).