About 2,3-dimethylbut-1-ene;2-methylbut-1-ene;2-methylbut-2-ene;3-methylhex-2-ene
2,3-dimethylbut-1-ene;2-methylbut-1-ene;2-methylbut-2-ene;3-methylhex-2-ene (PubChem CID 173400648) has the molecular formula C23H46
and a molecular weight of 322.62 g/mol. Its IUPAC name is 2,3-dimethylbut-1-ene;2-methylbut-1-ene;2-methylbut-2-ene;3-methylhex-2-ene.
Molecular Properties
| Compound Name | 2,3-dimethylbut-1-ene;2-methylbut-1-ene;2-methylbut-2-ene;3-methylhex-2-ene |
| PubChem CID | 173400648 |
| Molecular Formula | C23H46 |
| Molecular Weight | 322.62 g/mol |
| Exact Mass | 322.36 |
| IUPAC Name | 2,3-dimethylbut-1-ene;2-methylbut-1-ene;2-methylbut-2-ene;3-methylhex-2-ene |
| SMILES | C=C(C)C(C)C.C=C(C)CC.CC=C(C)C.CC=C(C)CCC |
| InChI | InChI=1S/C7H14.C6H12.2C5H10/c1-4-6-7(3)5-2;1-5(2)6(3)4;2*1-4-5(2)3/h5H,4,6H2,1-3H3;6H,1H2,2-4H3;4H,1-3H3;2,4H2,1,3H3 |
| InChIKey | ZTOCDRQBEARAGY-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.62 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylbut-1-ene;2-methylbut-1-ene;2-methylbut-2-ene;3-methylhex-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbut-1-ene;2-methylbut-1-ene;2-methylbut-2-ene;3-methylhex-2-ene?
The IUPAC name of 2,3-dimethylbut-1-ene;2-methylbut-1-ene;2-methylbut-2-ene;3-methylhex-2-ene (CID 173400648) is 2,3-dimethylbut-1-ene;2-methylbut-1-ene;2-methylbut-2-ene;3-methylhex-2-ene.
What is the SMILES notation for 2,3-dimethylbut-1-ene;2-methylbut-1-ene;2-methylbut-2-ene;3-methylhex-2-ene?
The canonical SMILES for 2,3-dimethylbut-1-ene;2-methylbut-1-ene;2-methylbut-2-ene;3-methylhex-2-ene is C=C(C)C(C)C.C=C(C)CC.CC=C(C)C.CC=C(C)CCC.
What is the InChIKey of 2,3-dimethylbut-1-ene;2-methylbut-1-ene;2-methylbut-2-ene;3-methylhex-2-ene?
The InChIKey is ZTOCDRQBEARAGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14.C6H12.2C5H10/c1-4-6-7(3)5-2;1-5(2)6(3)4;2*1-4-5(2)3/h5H,4,6H2,1-3H3;6H,1H2,2-4H3;4H,1-3H3;2,4H2,1,3H3.
What are the key properties of 2,3-dimethylbut-1-ene;2-methylbut-1-ene;2-methylbut-2-ene;3-methylhex-2-ene?
2,3-dimethylbut-1-ene;2-methylbut-1-ene;2-methylbut-2-ene;3-methylhex-2-ene has a molecular weight of 322.62 g/mol, XLogP of 8.92, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbut-1-ene;2-methylbut-1-ene;2-methylbut-2-ene;3-methylhex-2-ene is sourced from PubChem (CID 173400648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).