C16H23F2N — CID 166966272
(3E,6Z,8E)-8-(difluoromethyl)-4-ethenyl-N,N-dimethyl-5-methylidenedeca-3,6,8-trien-3-amine (PubChem CID 166966272) has the molecular formula C16H23F2N and a molecular weight of 267.36 g/mol. Its IUPAC name is (3E,6Z,8E)-8-(difluoromethyl)-4-ethenyl-N,N-dimethyl-5-methylidenedeca-3,6,8-trien-3-amine.
| Compound Name | (3E,6Z,8E)-8-(difluoromethyl)-4-ethenyl-N,N-dimethyl-5-methylidenedeca-3,6,8-trien-3-amine |
|---|---|
| PubChem CID | 166966272 |
| Molecular Formula | C16H23F2N |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | (3E,6Z,8E)-8-(difluoromethyl)-4-ethenyl-N,N-dimethyl-5-methylidenedeca-3,6,8-trien-3-amine |
| SMILES | C=C/C(C(=C)/C=C\C(=C/C)C(F)F)=C(/CC)N(C)C |
| InChI | InChI=1S/C16H23F2N/c1-7-13(16(17)18)11-10-12(4)14(8-2)15(9-3)19(5)6/h7-8,10-11,16H,2,4,9H2,1,3,5-6H3/b11-10-,13-7+,15-14+ |
| InChIKey | PNFGFMVLHMERHL-DYSZJUKTSA-N |
| XLogP | 4.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|