C13H21F2N3 — CID 145351431
(Z)-1-N-[(3E)-4-(difluoromethyl)hexa-1,3,5-trien-2-yl]-1-N,2-N,2-N-trimethylprop-1-ene-1,2,3-triamine (PubChem CID 145351431) has the molecular formula C13H21F2N3 and a molecular weight of 257.33 g/mol. Its IUPAC name is (Z)-1-N-[(3E)-4-(difluoromethyl)hexa-1,3,5-trien-2-yl]-1-N,2-N,2-N-trimethylprop-1-ene-1,2,3-triamine.
| Compound Name | (Z)-1-N-[(3E)-4-(difluoromethyl)hexa-1,3,5-trien-2-yl]-1-N,2-N,2-N-trimethylprop-1-ene-1,2,3-triamine |
|---|---|
| PubChem CID | 145351431 |
| Molecular Formula | C13H21F2N3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | (Z)-1-N-[(3E)-4-(difluoromethyl)hexa-1,3,5-trien-2-yl]-1-N,2-N,2-N-trimethylprop-1-ene-1,2,3-triamine |
| SMILES | C=C/C(=C\C(=C)N(C)/C=C(/CN)N(C)C)C(F)F |
| InChI | InChI=1S/C13H21F2N3/c1-6-11(13(14)15)7-10(2)18(5)9-12(8-16)17(3)4/h6-7,9,13H,1-2,8,16H2,3-5H3/b11-7+,12-9- |
| InChIKey | VMNJTAFAMRAMNR-WSWPAOCJSA-N |
| XLogP | 2.17 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|