C31H39NO6S — CID 123853582
6-prop-2-enoyloxyhexyl 3-[[2-(4-benzoylphenyl)sulfanylacetyl]-butylamino]propanoate (PubChem CID 123853582) has the molecular formula C31H39NO6S and a molecular weight of 553.72 g/mol. Its IUPAC name is 6-prop-2-enoyloxyhexyl 3-[[2-(4-benzoylphenyl)sulfanylacetyl]-butylamino]propanoate.
| Compound Name | 6-prop-2-enoyloxyhexyl 3-[[2-(4-benzoylphenyl)sulfanylacetyl]-butylamino]propanoate |
|---|---|
| PubChem CID | 123853582 |
| Molecular Formula | C31H39NO6S |
| Molecular Weight | 553.72 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | 6-prop-2-enoyloxyhexyl 3-[[2-(4-benzoylphenyl)sulfanylacetyl]-butylamino]propanoate |
| SMILES | C=CC(=O)OCCCCCCOC(=O)CCN(CCCC)C(=O)CSc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H39NO6S/c1-3-5-20-32(21-19-30(35)38-23-12-7-6-11-22-37-29(34)4-2)28(33)24-39-27-17-15-26(16-18-27)31(36)25-13-9-8-10-14-25/h4,8-10,13-18H,2-3,5-7,11-12,19-24H2,1H3 |
| InChIKey | NMJJOCTYTSSKQD-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.72 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|