C12H22F3NO2S — CID 123853938
2-[3-(5,5,5-trifluoropentylsulfonyl)propyl]pyrrolidine (PubChem CID 123853938) has the molecular formula C12H22F3NO2S and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-[3-(5,5,5-trifluoropentylsulfonyl)propyl]pyrrolidine.
| Compound Name | 2-[3-(5,5,5-trifluoropentylsulfonyl)propyl]pyrrolidine |
|---|---|
| PubChem CID | 123853938 |
| Molecular Formula | C12H22F3NO2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-[3-(5,5,5-trifluoropentylsulfonyl)propyl]pyrrolidine |
| SMILES | O=S(=O)(CCCCC(F)(F)F)CCCC1CCCN1 |
| InChI | InChI=1S/C12H22F3NO2S/c13-12(14,15)7-1-2-9-19(17,18)10-4-6-11-5-3-8-16-11/h11,16H,1-10H2 |
| InChIKey | BTQAKMJQKGBBSD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|