C10H13NS — CID 123854566
4-methylsulfanyl-1,2,3,8a-tetrahydroisoquinoline (PubChem CID 123854566) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is 4-methylsulfanyl-1,2,3,8a-tetrahydroisoquinoline.
| Compound Name | 4-methylsulfanyl-1,2,3,8a-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 123854566 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 4-methylsulfanyl-1,2,3,8a-tetrahydroisoquinoline |
| SMILES | CSC1=C2C=CC=CC2CNC1 |
| InChI | InChI=1S/C10H13NS/c1-12-10-7-11-6-8-4-2-3-5-9(8)10/h2-5,8,11H,6-7H2,1H3 |
| InChIKey | DIMFKHWMEAFDRU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |