C19H14ClF6N5O — CID 123854669
1-(3-chloro-5-fluorophenyl)-3-[5-(difluoromethyl)-1H-pyrazol-3-yl]-2-[hydroxy-[4-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 123854669) has the molecular formula C19H14ClF6N5O and a molecular weight of 477.80 g/mol. Its IUPAC name is 1-(3-chloro-5-fluorophenyl)-3-[5-(difluoromethyl)-1H-pyrazol-3-yl]-2-[hydroxy-[4-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-(3-chloro-5-fluorophenyl)-3-[5-(difluoromethyl)-1H-pyrazol-3-yl]-2-[hydroxy-[4-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 123854669 |
| Molecular Formula | C19H14ClF6N5O |
| Molecular Weight | 477.80 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 1-(3-chloro-5-fluorophenyl)-3-[5-(difluoromethyl)-1H-pyrazol-3-yl]-2-[hydroxy-[4-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | OC(N=C(Nc1cc(F)cc(Cl)c1)Nc1cc(C(F)F)[nH]n1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H14ClF6N5O/c20-11-5-12(21)7-13(6-11)27-18(28-15-8-14(16(22)23)30-31-15)29-17(32)9-1-3-10(4-2-9)19(24,25)26/h1-8,16-17,32H,(H3,27,28,29,30,31) |
| InChIKey | PIXMQZSZVAEBOE-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.80 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|