C12H16BClF2O2 — CID 123854680
2-(4-chloro-3,6-difluorocyclohexa-2,4-dien-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 123854680) has the molecular formula C12H16BClF2O2 and a molecular weight of 276.52 g/mol. Its IUPAC name is 2-(4-chloro-3,6-difluorocyclohexa-2,4-dien-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(4-chloro-3,6-difluorocyclohexa-2,4-dien-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 123854680 |
| Molecular Formula | C12H16BClF2O2 |
| Molecular Weight | 276.52 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2-(4-chloro-3,6-difluorocyclohexa-2,4-dien-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C2C=C(F)C(Cl)=CC2F)OC1(C)C |
| InChI | InChI=1S/C12H16BClF2O2/c1-11(2)12(3,4)18-13(17-11)7-5-10(16)8(14)6-9(7)15/h5-7,9H,1-4H3 |
| InChIKey | QRLFMLPGWWZDAN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|