C13H19BF2O2 — CID 171626876
2-(4,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171626876) has the molecular formula C13H19BF2O2 and a molecular weight of 256.10 g/mol. Its IUPAC name is 2-(4,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(4,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171626876 |
| Molecular Formula | C13H19BF2O2 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2-(4,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(F)C=C(F)C(B2OC(C)(C)C(C)(C)O2)=CC1 |
| InChI | InChI=1S/C13H19BF2O2/c1-11(2)12(3,4)18-14(17-11)9-6-7-13(5,16)8-10(9)15/h6,8H,7H2,1-5H3 |
| InChIKey | OPRKHGZBUFADNJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|