C13H18BBrF2O2 — CID 142700818
2-[6-(bromomethyl)-2,6-difluorocyclohexa-2,4-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 142700818) has the molecular formula C13H18BBrF2O2 and a molecular weight of 335.00 g/mol. Its IUPAC name is 2-[6-(bromomethyl)-2,6-difluorocyclohexa-2,4-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[6-(bromomethyl)-2,6-difluorocyclohexa-2,4-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 142700818 |
| Molecular Formula | C13H18BBrF2O2 |
| Molecular Weight | 335.00 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 2-[6-(bromomethyl)-2,6-difluorocyclohexa-2,4-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C2C(F)=CC=CC2(F)CBr)OC1(C)C |
| InChI | InChI=1S/C13H18BBrF2O2/c1-11(2)12(3,4)19-14(18-11)10-9(16)6-5-7-13(10,17)8-15/h5-7,10H,8H2,1-4H3 |
| InChIKey | FTHMYSMSZHFMLP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.00 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|