C12H15BF8O2 — CID 165415753
4,4,5,5-tetramethyl-2-[(Z)-3,4,4,5,5,6,6,6-octafluorohex-2-enyl]-1,3,2-dioxaborolane (PubChem CID 165415753) has the molecular formula C12H15BF8O2 and a molecular weight of 354.05 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(Z)-3,4,4,5,5,6,6,6-octafluorohex-2-enyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(Z)-3,4,4,5,5,6,6,6-octafluorohex-2-enyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 165415753 |
| Molecular Formula | C12H15BF8O2 |
| Molecular Weight | 354.05 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(Z)-3,4,4,5,5,6,6,6-octafluorohex-2-enyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C/C=C(\F)C(F)(F)C(F)(F)C(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C12H15BF8O2/c1-8(2)9(3,4)23-13(22-8)6-5-7(14)10(15,16)11(17,18)12(19,20)21/h5H,6H2,1-4H3/b7-5- |
| InChIKey | KBXOHLTZRUXMCG-ALCCZGGFSA-N |
| XLogP | 4.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.05 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|