C12H21BF2O2 — CID 170757565
2-[(Z)-6,6-difluorohex-2-en-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 170757565) has the molecular formula C12H21BF2O2 and a molecular weight of 246.11 g/mol. Its IUPAC name is 2-[(Z)-6,6-difluorohex-2-en-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(Z)-6,6-difluorohex-2-en-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 170757565 |
| Molecular Formula | C12H21BF2O2 |
| Molecular Weight | 246.11 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 2-[(Z)-6,6-difluorohex-2-en-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C/C=C(\CCC(F)F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C12H21BF2O2/c1-6-9(7-8-10(14)15)13-16-11(2,3)12(4,5)17-13/h6,10H,7-8H2,1-5H3/b9-6+ |
| InChIKey | YYYGUDZVWORFSY-RMKNXTFCSA-N |
| XLogP | 3.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.11 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|