C18H26BF9O2 — CID 146165125
4,4,5,5-tetramethyl-2-[(E,5R)-9,9,10,10,11,11,12,12,12-nonafluorododec-6-en-5-yl]-1,3,2-dioxaborolane (PubChem CID 146165125) has the molecular formula C18H26BF9O2 and a molecular weight of 456.20 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(E,5R)-9,9,10,10,11,11,12,12,12-nonafluorododec-6-en-5-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(E,5R)-9,9,10,10,11,11,12,12,12-nonafluorododec-6-en-5-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 146165125 |
| Molecular Formula | C18H26BF9O2 |
| Molecular Weight | 456.20 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(E,5R)-9,9,10,10,11,11,12,12,12-nonafluorododec-6-en-5-yl]-1,3,2-dioxaborolane |
| SMILES | CCCC[C@H](/C=C/CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H26BF9O2/c1-6-7-9-12(19-29-13(2,3)14(4,5)30-19)10-8-11-15(20,21)16(22,23)17(24,25)18(26,27)28/h8,10,12H,6-7,9,11H2,1-5H3/b10-8+/t12-/m1/s1 |
| InChIKey | ZWBGNCIIPWHISB-ZJNQMXKESA-N |
| XLogP | 7.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.20 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|