C15H26BF3O2 — CID 170757577
ethane;4,4,5,5-tetramethyl-2-[4-(trifluoromethyl)cyclohexen-1-yl]-1,3,2-dioxaborolane (PubChem CID 170757577) has the molecular formula C15H26BF3O2 and a molecular weight of 306.18 g/mol. Its IUPAC name is ethane;4,4,5,5-tetramethyl-2-[4-(trifluoromethyl)cyclohexen-1-yl]-1,3,2-dioxaborolane.
| Compound Name | ethane;4,4,5,5-tetramethyl-2-[4-(trifluoromethyl)cyclohexen-1-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 170757577 |
| Molecular Formula | C15H26BF3O2 |
| Molecular Weight | 306.18 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | ethane;4,4,5,5-tetramethyl-2-[4-(trifluoromethyl)cyclohexen-1-yl]-1,3,2-dioxaborolane |
| SMILES | CC.CC1(C)OB(C2=CCC(C(F)(F)F)CC2)OC1(C)C |
| InChI | InChI=1S/C13H20BF3O2.C2H6/c1-11(2)12(3,4)19-14(18-11)10-7-5-9(6-8-10)13(15,16)17;1-2/h7,9H,5-6,8H2,1-4H3;1-2H3 |
| InChIKey | UNNWKAIOIDQQGD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.18 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|