C15H25BF2O2 — CID 177469361
2-[(1R)-1-cyclohexyl-3,3-difluoroprop-2-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 177469361) has the molecular formula C15H25BF2O2 and a molecular weight of 286.17 g/mol. Its IUPAC name is 2-[(1R)-1-cyclohexyl-3,3-difluoroprop-2-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(1R)-1-cyclohexyl-3,3-difluoroprop-2-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 177469361 |
| Molecular Formula | C15H25BF2O2 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 2-[(1R)-1-cyclohexyl-3,3-difluoroprop-2-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB([C@@H](C=C(F)F)C2CCCCC2)OC1(C)C |
| InChI | InChI=1S/C15H25BF2O2/c1-14(2)15(3,4)20-16(19-14)12(10-13(17)18)11-8-6-5-7-9-11/h10-12H,5-9H2,1-4H3/t12-/m0/s1 |
| InChIKey | SSJIUZAQIRGMHO-LBPRGKRZSA-N |
| XLogP | 4.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|