C15H27BF2O2 — CID 177421331
2-[(3R)-1,1-difluoronon-1-en-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 177421331) has the molecular formula C15H27BF2O2 and a molecular weight of 288.19 g/mol. Its IUPAC name is 2-[(3R)-1,1-difluoronon-1-en-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(3R)-1,1-difluoronon-1-en-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 177421331 |
| Molecular Formula | C15H27BF2O2 |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 2-[(3R)-1,1-difluoronon-1-en-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCC[C@H](C=C(F)F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H27BF2O2/c1-6-7-8-9-10-12(11-13(17)18)16-19-14(2,3)15(4,5)20-16/h11-12H,6-10H2,1-5H3/t12-/m1/s1 |
| InChIKey | JLEKXRBSXGRXOA-GFCCVEGCSA-N |
| XLogP | 5.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|