C14H13BF13IO2 — CID 102482098
4,4,5,5-tetramethyl-2-[(E)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-iodooct-1-enyl]-1,3,2-dioxaborolane (PubChem CID 102482098) has the molecular formula C14H13BF13IO2 and a molecular weight of 597.95 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(E)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-iodooct-1-enyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(E)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-iodooct-1-enyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 102482098 |
| Molecular Formula | C14H13BF13IO2 |
| Molecular Weight | 597.95 g/mol |
| Exact Mass | 597.98 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(E)-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluoro-1-iodooct-1-enyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(/C(I)=C\C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C14H13BF13IO2/c1-7(2)8(3,4)31-15(30-7)6(29)5-9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)28/h5H,1-4H3/b6-5+ |
| InChIKey | IDHKODSLUDJLHB-AATRIKPKSA-N |
| XLogP | 6.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.95 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|