C11H13BF7IO2 — CID 102482101
2-[(E)-3,3,4,4,5,5,5-heptafluoro-1-iodopent-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 102482101) has the molecular formula C11H13BF7IO2 and a molecular weight of 447.93 g/mol. Its IUPAC name is 2-[(E)-3,3,4,4,5,5,5-heptafluoro-1-iodopent-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(E)-3,3,4,4,5,5,5-heptafluoro-1-iodopent-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 102482101 |
| Molecular Formula | C11H13BF7IO2 |
| Molecular Weight | 447.93 g/mol |
| Exact Mass | 447.99 |
| IUPAC Name | 2-[(E)-3,3,4,4,5,5,5-heptafluoro-1-iodopent-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(/C(I)=C\C(F)(F)C(F)(F)C(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C11H13BF7IO2/c1-7(2)8(3,4)22-12(21-7)6(20)5-9(13,14)10(15,16)11(17,18)19/h5H,1-4H3/b6-5+ |
| InChIKey | GJRCMLPVMNXSJV-AATRIKPKSA-N |
| XLogP | 4.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.93 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|