C9H13BF4O2 — CID 171109654
4,4,5,5-tetramethyl-2-(1,3,3,3-tetrafluoroprop-1-enyl)-1,3,2-dioxaborolane (PubChem CID 171109654) has the molecular formula C9H13BF4O2 and a molecular weight of 240.00 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(1,3,3,3-tetrafluoroprop-1-enyl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(1,3,3,3-tetrafluoroprop-1-enyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171109654 |
| Molecular Formula | C9H13BF4O2 |
| Molecular Weight | 240.00 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(1,3,3,3-tetrafluoroprop-1-enyl)-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(F)=CC(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C9H13BF4O2/c1-7(2)8(3,4)16-10(15-7)6(11)5-9(12,13)14/h5H,1-4H3 |
| InChIKey | KJHBDSIQAUUZRC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.00 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|