C13H21BF2O2 — CID 125180256
2-[(4,4-difluorocyclohexen-1-yl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 125180256) has the molecular formula C13H21BF2O2 and a molecular weight of 258.12 g/mol. Its IUPAC name is 2-[(4,4-difluorocyclohexen-1-yl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(4,4-difluorocyclohexen-1-yl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 125180256 |
| Molecular Formula | C13H21BF2O2 |
| Molecular Weight | 258.12 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 2-[(4,4-difluorocyclohexen-1-yl)methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(CC2=CCC(F)(F)CC2)OC1(C)C |
| InChI | InChI=1S/C13H21BF2O2/c1-11(2)12(3,4)18-14(17-11)9-10-5-7-13(15,16)8-6-10/h5H,6-9H2,1-4H3 |
| InChIKey | CORFNXHHWZOOFZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.12 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|