C14H25BF2O2 — CID 145231185
2-(4,4-difluorocyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethane (PubChem CID 145231185) has the molecular formula C14H25BF2O2 and a molecular weight of 274.16 g/mol. Its IUPAC name is 2-(4,4-difluorocyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethane.
| Compound Name | 2-(4,4-difluorocyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethane |
|---|---|
| PubChem CID | 145231185 |
| Molecular Formula | C14H25BF2O2 |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 2-(4,4-difluorocyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;ethane |
| SMILES | CC.CC1(C)OB(C2=CCC(F)(F)CC2)OC1(C)C |
| InChI | InChI=1S/C12H19BF2O2.C2H6/c1-10(2)11(3,4)17-13(16-10)9-5-7-12(14,15)8-6-9;1-2/h5H,6-8H2,1-4H3;1-2H3 |
| InChIKey | FQLBZFDDRFNTGZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|