C47H49FN5O3Si — CID 123855154
CID 123855154 (PubChem CID 123855154) has the molecular formula C47H49FN5O3Si and a molecular weight of 779.03 g/mol.
| Compound Name | CID 123855154 |
|---|---|
| PubChem CID | 123855154 |
| Molecular Formula | C47H49FN5O3Si |
| Molecular Weight | 779.03 g/mol |
| Exact Mass | 778.36 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cccc(-c3ncnc4[nH]c(C5=CCN(C(=O)CF)CC5)cc34)c2COCC(C)(C)[Si](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C47H49FN5O3Si/c1-46(2,3)34-21-19-33(20-22-34)45(55)52-40-18-12-17-37(43-38-27-41(51-44(38)50-31-49-43)32-23-25-53(26-24-32)42(54)28-48)39(40)29-56-30-47(4,5)57(35-13-8-6-9-14-35)36-15-10-7-11-16-36/h6-23,27,31H,24-26,28-30H2,1-5H3,(H,52,55)(H,49,50,51) |
| InChIKey | GDTQJHMASWDGIO-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.03 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|