C45H48N5O2Si — CID 123153032
CID 123153032 (PubChem CID 123153032) has the molecular formula C45H48N5O2Si and a molecular weight of 719.00 g/mol.
| Compound Name | CID 123153032 |
|---|---|
| PubChem CID | 123153032 |
| Molecular Formula | C45H48N5O2Si |
| Molecular Weight | 719.00 g/mol |
| Exact Mass | 718.36 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cccc(-c3ncnc4[nH]c(C5=CCNCC5)cc34)c2COCC(C)(C)[Si](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C45H48N5O2Si/c1-44(2,3)33-21-19-32(20-22-33)43(51)50-39-18-12-17-36(41-37-27-40(31-23-25-46-26-24-31)49-42(37)48-30-47-41)38(39)28-52-29-45(4,5)53(34-13-8-6-9-14-34)35-15-10-7-11-16-35/h6-23,27,30,46H,24-26,28-29H2,1-5H3,(H,50,51)(H,47,48,49) |
| InChIKey | LCEQGEJXDUPKIV-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.00 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|