C28H24N4O3 — CID 169204110
N-[3-[6-(4-formylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-2-methylphenyl]benzamide;methanol (PubChem CID 169204110) has the molecular formula C28H24N4O3 and a molecular weight of 464.53 g/mol. Its IUPAC name is N-[3-[6-(4-formylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-2-methylphenyl]benzamide;methanol.
| Compound Name | N-[3-[6-(4-formylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-2-methylphenyl]benzamide;methanol |
|---|---|
| PubChem CID | 169204110 |
| Molecular Formula | C28H24N4O3 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | N-[3-[6-(4-formylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-2-methylphenyl]benzamide;methanol |
| SMILES | CO.Cc1c(NC(=O)c2ccccc2)cccc1-c1ncnc2[nH]c(-c3ccc(C=O)cc3)cc12 |
| InChI | InChI=1S/C27H20N4O2.CH4O/c1-17-21(8-5-9-23(17)31-27(33)20-6-3-2-4-7-20)25-22-14-24(30-26(22)29-16-28-25)19-12-10-18(15-32)11-13-19;1-2/h2-16H,1H3,(H,31,33)(H,28,29,30);2H,1H3 |
| InChIKey | ADEPGYALMDMMHV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|