About 4-(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-6-yl)benzaldehyde;ethane;methoxymethane
4-(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-6-yl)benzaldehyde;ethane;methoxymethane (PubChem CID 169204042) has the molecular formula C17H20ClN3O2
and a molecular weight of 333.82 g/mol. Its IUPAC name is 4-(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-6-yl)benzaldehyde;ethane;methoxymethane.
Molecular Properties
| Compound Name | 4-(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-6-yl)benzaldehyde;ethane;methoxymethane |
| PubChem CID | 169204042 |
| Molecular Formula | C17H20ClN3O2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 4-(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-6-yl)benzaldehyde;ethane;methoxymethane |
| SMILES | CC.COC.O=Cc1ccc(-c2cc3c(Cl)ncnc3[nH]2)cc1 |
| InChI | InChI=1S/C13H8ClN3O.C2H6O.C2H6/c14-12-10-5-11(17-13(10)16-7-15-12)9-3-1-8(6-18)2-4-9;1-3-2;1-2/h1-7H,(H,15,16,17);1-2H3;1-2H3 |
| InChIKey | HJKSUWDDXPFBMU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-6-yl)benzaldehyde;ethane;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-6-yl)benzaldehyde;ethane;methoxymethane?
The IUPAC name of 4-(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-6-yl)benzaldehyde;ethane;methoxymethane (CID 169204042) is 4-(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-6-yl)benzaldehyde;ethane;methoxymethane.
What is the SMILES notation for 4-(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-6-yl)benzaldehyde;ethane;methoxymethane?
The canonical SMILES for 4-(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-6-yl)benzaldehyde;ethane;methoxymethane is CC.COC.O=Cc1ccc(-c2cc3c(Cl)ncnc3[nH]2)cc1.
What is the InChIKey of 4-(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-6-yl)benzaldehyde;ethane;methoxymethane?
The InChIKey is HJKSUWDDXPFBMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClN3O.C2H6O.C2H6/c14-12-10-5-11(17-13(10)16-7-15-12)9-3-1-8(6-18)2-4-9;1-3-2;1-2/h1-7H,(H,15,16,17);1-2H3;1-2H3.
What are the key properties of 4-(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-6-yl)benzaldehyde;ethane;methoxymethane?
4-(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-6-yl)benzaldehyde;ethane;methoxymethane has a molecular weight of 333.82 g/mol, XLogP of 4.38, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chloro-7H-pyrrolo[2,3-d]pyrimidin-6-yl)benzaldehyde;ethane;methoxymethane is sourced from PubChem (CID 169204042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).