C19H20ClN5O — CID 118537783
4-chloro-6-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-7H-pyrrolo[2,3-d]pyrimidine (PubChem CID 118537783) has the molecular formula C19H20ClN5O and a molecular weight of 369.86 g/mol. Its IUPAC name is 4-chloro-6-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-7H-pyrrolo[2,3-d]pyrimidine.
| Compound Name | 4-chloro-6-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 118537783 |
| Molecular Formula | C19H20ClN5O |
| Molecular Weight | 369.86 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 4-chloro-6-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-7H-pyrrolo[2,3-d]pyrimidine |
| SMILES | Clc1ncnc2[nH]c(-c3ccc(N4CCN(C5COC5)CC4)cc3)cc12 |
| InChI | InChI=1S/C19H20ClN5O/c20-18-16-9-17(23-19(16)22-12-21-18)13-1-3-14(4-2-13)24-5-7-25(8-6-24)15-10-26-11-15/h1-4,9,12,15H,5-8,10-11H2,(H,21,22,23) |
| InChIKey | LCKWGFKAPFXEQF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.86 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|