C21H25ClN4 — CID 164564176
1-[4-(4-chloro-5-methyl-1H-pyrrolo[2,3-b]pyridin-2-yl)phenyl]-N,N-dimethylpiperidin-4-amine (PubChem CID 164564176) has the molecular formula C21H25ClN4 and a molecular weight of 368.91 g/mol. Its IUPAC name is 1-[4-(4-chloro-5-methyl-1H-pyrrolo[2,3-b]pyridin-2-yl)phenyl]-N,N-dimethylpiperidin-4-amine.
| Compound Name | 1-[4-(4-chloro-5-methyl-1H-pyrrolo[2,3-b]pyridin-2-yl)phenyl]-N,N-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 164564176 |
| Molecular Formula | C21H25ClN4 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 1-[4-(4-chloro-5-methyl-1H-pyrrolo[2,3-b]pyridin-2-yl)phenyl]-N,N-dimethylpiperidin-4-amine |
| SMILES | Cc1cnc2[nH]c(-c3ccc(N4CCC(N(C)C)CC4)cc3)cc2c1Cl |
| InChI | InChI=1S/C21H25ClN4/c1-14-13-23-21-18(20(14)22)12-19(24-21)15-4-6-17(7-5-15)26-10-8-16(9-11-26)25(2)3/h4-7,12-13,16H,8-11H2,1-3H3,(H,23,24) |
| InChIKey | XQMBTRVDEOSMLA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|