C29H36N5OP — CID 164564195
2-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-N-(2-dimethylphosphanyl-3-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 164564195) has the molecular formula C29H36N5OP and a molecular weight of 501.62 g/mol. Its IUPAC name is 2-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-N-(2-dimethylphosphanyl-3-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-4-amine.
| Compound Name | 2-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-N-(2-dimethylphosphanyl-3-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 164564195 |
| Molecular Formula | C29H36N5OP |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | 2-[4-[4-(dimethylamino)piperidin-1-yl]phenyl]-N-(2-dimethylphosphanyl-3-methoxyphenyl)-1H-pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | COc1cccc(Nc2ccnc3[nH]c(-c4ccc(N5CCC(N(C)C)CC5)cc4)cc23)c1P(C)C |
| InChI | InChI=1S/C29H36N5OP/c1-33(2)21-14-17-34(18-15-21)22-11-9-20(10-12-22)26-19-23-24(13-16-30-29(23)32-26)31-25-7-6-8-27(35-3)28(25)36(4)5/h6-13,16,19,21H,14-15,17-18H2,1-5H3,(H2,30,31,32) |
| InChIKey | NGRLDFXHSHWFTG-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 56.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|