C32H37N4O3P — CID 164564172
N-(2-dicyclopropylphosphoryl-3-methoxyphenyl)-2-[4-(1-methylpiperidin-4-yl)oxyphenyl]-1H-pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 164564172) has the molecular formula C32H37N4O3P and a molecular weight of 556.65 g/mol. Its IUPAC name is N-(2-dicyclopropylphosphoryl-3-methoxyphenyl)-2-[4-(1-methylpiperidin-4-yl)oxyphenyl]-1H-pyrrolo[2,3-b]pyridin-4-amine.
| Compound Name | N-(2-dicyclopropylphosphoryl-3-methoxyphenyl)-2-[4-(1-methylpiperidin-4-yl)oxyphenyl]-1H-pyrrolo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 164564172 |
| Molecular Formula | C32H37N4O3P |
| Molecular Weight | 556.65 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | N-(2-dicyclopropylphosphoryl-3-methoxyphenyl)-2-[4-(1-methylpiperidin-4-yl)oxyphenyl]-1H-pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | COc1cccc(Nc2ccnc3[nH]c(-c4ccc(OC5CCN(C)CC5)cc4)cc23)c1P(=O)(C1CC1)C1CC1 |
| InChI | InChI=1S/C32H37N4O3P/c1-36-18-15-23(16-19-36)39-22-8-6-21(7-9-22)29-20-26-27(14-17-33-32(26)35-29)34-28-4-3-5-30(38-2)31(28)40(37,24-10-11-24)25-12-13-25/h3-9,14,17,20,23-25H,10-13,15-16,18-19H2,1-2H3,(H2,33,34,35) |
| InChIKey | UYTVEAYQLCIMBY-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.65 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|