C28H32N5O3P — CID 164564186
[4-[4-(2-dimethylphosphanylanilino)-1H-pyrrolo[2,3-b]pyridin-2-yl]phenyl]-(4-methylpiperazin-1-yl)methanone;formic acid (PubChem CID 164564186) has the molecular formula C28H32N5O3P and a molecular weight of 517.57 g/mol. Its IUPAC name is [4-[4-(2-dimethylphosphanylanilino)-1H-pyrrolo[2,3-b]pyridin-2-yl]phenyl]-(4-methylpiperazin-1-yl)methanone;formic acid.
| Compound Name | [4-[4-(2-dimethylphosphanylanilino)-1H-pyrrolo[2,3-b]pyridin-2-yl]phenyl]-(4-methylpiperazin-1-yl)methanone;formic acid |
|---|---|
| PubChem CID | 164564186 |
| Molecular Formula | C28H32N5O3P |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | [4-[4-(2-dimethylphosphanylanilino)-1H-pyrrolo[2,3-b]pyridin-2-yl]phenyl]-(4-methylpiperazin-1-yl)methanone;formic acid |
| SMILES | CN1CCN(C(=O)c2ccc(-c3cc4c(Nc5ccccc5P(C)C)ccnc4[nH]3)cc2)CC1.O=CO |
| InChI | InChI=1S/C27H30N5OP.CH2O2/c1-31-14-16-32(17-15-31)27(33)20-10-8-19(9-11-20)24-18-21-22(12-13-28-26(21)30-24)29-23-6-4-5-7-25(23)34(2)3;2-1-3/h4-13,18H,14-17H2,1-3H3,(H2,28,29,30);1H,(H,2,3) |
| InChIKey | XZUPKAMATIXPDR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 101.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|