C26H32N5OP — CID 167150959
N'-[4-[4-(2-dimethylphosphorylanilino)-1H-pyrrolo[2,3-b]pyridin-2-yl]phenyl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 167150959) has the molecular formula C26H32N5OP and a molecular weight of 461.55 g/mol. Its IUPAC name is N'-[4-[4-(2-dimethylphosphorylanilino)-1H-pyrrolo[2,3-b]pyridin-2-yl]phenyl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-[4-[4-(2-dimethylphosphorylanilino)-1H-pyrrolo[2,3-b]pyridin-2-yl]phenyl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 167150959 |
| Molecular Formula | C26H32N5OP |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | N'-[4-[4-(2-dimethylphosphorylanilino)-1H-pyrrolo[2,3-b]pyridin-2-yl]phenyl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CN(C)CCN(C)c1ccc(-c2cc3c(Nc4ccccc4P(C)(C)=O)ccnc3[nH]2)cc1 |
| InChI | InChI=1S/C26H32N5OP/c1-30(2)16-17-31(3)20-12-10-19(11-13-20)24-18-21-22(14-15-27-26(21)29-24)28-23-8-6-7-9-25(23)33(4,5)32/h6-15,18H,16-17H2,1-5H3,(H2,27,28,29) |
| InChIKey | VKWOOBLXQABIJB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|