C29H29N5 — CID 68932914
N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-6-(1H-indol-4-yl)quinolin-4-amine (PubChem CID 68932914) has the molecular formula C29H29N5 and a molecular weight of 447.59 g/mol. Its IUPAC name is N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-6-(1H-indol-4-yl)quinolin-4-amine.
| Compound Name | N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-6-(1H-indol-4-yl)quinolin-4-amine |
|---|---|
| PubChem CID | 68932914 |
| Molecular Formula | C29H29N5 |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-6-(1H-indol-4-yl)quinolin-4-amine |
| SMILES | CN(C)C1CCN(c2ccc(Nc3ccnc4ccc(-c5cccc6[nH]ccc56)cc34)cc2)C1 |
| InChI | InChI=1S/C29H29N5/c1-33(2)23-14-17-34(19-23)22-9-7-21(8-10-22)32-29-13-16-31-28-11-6-20(18-26(28)29)24-4-3-5-27-25(24)12-15-30-27/h3-13,15-16,18,23,30H,14,17,19H2,1-2H3,(H,31,32) |
| InChIKey | GUCDDAAXOYMGPI-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 47.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|