C15H20N4 — CID 141145994
(3S)-N,N-dimethyl-1-(4-pyrazol-1-ylphenyl)pyrrolidin-3-amine (PubChem CID 141145994) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is (3S)-N,N-dimethyl-1-(4-pyrazol-1-ylphenyl)pyrrolidin-3-amine.
| Compound Name | (3S)-N,N-dimethyl-1-(4-pyrazol-1-ylphenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 141145994 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | (3S)-N,N-dimethyl-1-(4-pyrazol-1-ylphenyl)pyrrolidin-3-amine |
| SMILES | CN(C)[C@H]1CCN(c2ccc(-n3cccn3)cc2)C1 |
| InChI | InChI=1S/C15H20N4/c1-17(2)15-8-11-18(12-15)13-4-6-14(7-5-13)19-10-3-9-16-19/h3-7,9-10,15H,8,11-12H2,1-2H3/t15-/m0/s1 |
| InChIKey | UFIPTOVYRSHWPY-HNNXBMFYSA-N |
| XLogP | 2.01 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|