C21H28N6 — CID 46991989
N-(4-pyrazol-1-ylbutan-2-yl)-1-(4-pyrazol-1-ylphenyl)piperidin-4-amine (PubChem CID 46991989) has the molecular formula C21H28N6 and a molecular weight of 364.50 g/mol. Its IUPAC name is N-(4-pyrazol-1-ylbutan-2-yl)-1-(4-pyrazol-1-ylphenyl)piperidin-4-amine.
| Compound Name | N-(4-pyrazol-1-ylbutan-2-yl)-1-(4-pyrazol-1-ylphenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 46991989 |
| Molecular Formula | C21H28N6 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | N-(4-pyrazol-1-ylbutan-2-yl)-1-(4-pyrazol-1-ylphenyl)piperidin-4-amine |
| SMILES | CC(CCn1cccn1)NC1CCN(c2ccc(-n3cccn3)cc2)CC1 |
| InChI | InChI=1S/C21H28N6/c1-18(8-17-26-13-2-11-22-26)24-19-9-15-25(16-10-19)20-4-6-21(7-5-20)27-14-3-12-23-27/h2-7,11-14,18-19,24H,8-10,15-17H2,1H3 |
| InChIKey | FWJNVEXDAGQIHS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 50.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|