C21H28N6 — CID 95046077
1-(4-imidazol-1-ylphenyl)-N-[(2R)-4-pyrazol-1-ylbutan-2-yl]piperidin-4-amine (PubChem CID 95046077) has the molecular formula C21H28N6 and a molecular weight of 364.50 g/mol. Its IUPAC name is 1-(4-imidazol-1-ylphenyl)-N-[(2R)-4-pyrazol-1-ylbutan-2-yl]piperidin-4-amine.
| Compound Name | 1-(4-imidazol-1-ylphenyl)-N-[(2R)-4-pyrazol-1-ylbutan-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 95046077 |
| Molecular Formula | C21H28N6 |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 1-(4-imidazol-1-ylphenyl)-N-[(2R)-4-pyrazol-1-ylbutan-2-yl]piperidin-4-amine |
| SMILES | C[C@H](CCn1cccn1)NC1CCN(c2ccc(-n3ccnc3)cc2)CC1 |
| InChI | InChI=1S/C21H28N6/c1-18(7-15-27-12-2-10-23-27)24-19-8-13-25(14-9-19)20-3-5-21(6-4-20)26-16-11-22-17-26/h2-6,10-12,16-19,24H,7-9,13-15H2,1H3/t18-/m1/s1 |
| InChIKey | GIUQSTBMXOOMBH-GOSISDBHSA-N |
| XLogP | 3.11 |
| TPSA | 50.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|